(E)-3-(dimethylamino)-2-methoxyprop-2-enal
Catalog No: FT-0773955
CAS No: 13616-34-7
- Chemical Name: (E)-3-(dimethylamino)-2-methoxyprop-2-enal
- Molecular Formula: C6H11NO2
- Molecular Weight: 129.16 g/mol
- InChI Key: RQHGOEZWYCFGCY-GQCTYLIASA-N
- InChI: InChI=1S/C6H11NO2/c1-7(2)4-6(5-8)9-3/h4-5H,1-3H3/b6-4+
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 304.1ºC at 760mmHg |
|---|---|
| CAS: | 13616-34-7 |
| MF: | C6H11NO2 |
| Density: | 0.979g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | (E)-3-(Dimethylamino)-2-methoxyacrylaldehyde |
| Flash_Point: | 137.7ºC |
| FW: | 129.15700 |
| Bolling_Point: | 304.1ºC at 760mmHg |
|---|---|
| Density: | 0.979g/cm3 |
| MF: | C6H11NO2 |
| LogP: | 0.23470 |
| Exact_Mass: | 129.07900 |
| Vapor_Pressure: | 0.000891mmHg at 25°C |
| Flash_Point: | 137.7ºC |
| FW: | 129.15700 |
| Refractive_Index: | 1.449 |
| PSA: | 29.54000 |
| HS_Code: | 2922509090 |
|---|
Related Products
Carbonic dichloride,polymer with 4,4-(1-methylethylidene)bis2,6-dibromophenol and 4,4-(1-methylethylidene)bisphenol