![2-[5-(4-chlorophenyl)pentyl]oxirane-2-carboxylic acid (CAS: 88431-47-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0716988.png "2-[5-(4-chlorophenyl)pentyl]oxirane-2-carboxylic acid chemical structure")
2-[5-(4-chlorophenyl)pentyl]oxirane-2-carboxylic acid
Catalog No: FT-0716988
CAS No: 88431-47-4
- Chemical Name: 2-[5-(4-chlorophenyl)pentyl]oxirane-2-carboxylic acid
- Molecular Formula: C14H17ClO3
- Molecular Weight: 268.73
- InChI Key: ACZKTJZXXSHIGF-UHFFFAOYSA-N
- InChI: InChI=1S/C14H17ClO3/c15-12-7-5-11(6-8-12)4-2-1-3-9-14(10-18-14)13(16)17/h5-8H,1-4,9-10H2,(H,16,17)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | N/A |
|---|---|
| FW: | 268.73600 |
| CAS: | 88431-47-4 |
| MF: | C14H17ClO3 |
| Flash_Point: | 202.6ºC |
| Product_Name: | 2-[5-(4-chlorophenyl)pentyl]oxirane-2-carboxylic acid |
| Bolling_Point: | 411.5ºC at 760 mmHg |
| Density: | 1.251g/cm3 |
| FW: | 268.73600 |
|---|---|
| Refractive_Index: | 1.56 |
| MF: | C14H17ClO3 |
| Exact_Mass: | 268.08700 |
| LogP: | 3.29650 |
| Bolling_Point: | 411.5ºC at 760 mmHg |
| Density: | 1.251g/cm3 |
| PSA: | 49.83000 |
| Flash_Point: | 202.6ºC |
| RTECS: | YE0875000 |
|---|---|
| Safety_Statements: | 53-36/37-45 |
| Hazard_Codes: | T: Toxic; |
| Risk_Statements(EU): | 60-63 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)