![[2-(4-Methylpiperazin-1-yl)butyl]amine (CAS: 953739-57-6) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0683299.png "[2-(4-Methylpiperazin-1-yl)butyl]amine chemical structure")
[2-(4-Methylpiperazin-1-yl)butyl]amine
Catalog No: FT-0683299
CAS No: 953739-57-6
- Chemical Name: [2-(4-Methylpiperazin-1-yl)butyl]amine
- Molecular Formula: C9H21N3
- Molecular Weight: 171.28
- InChI Key: IOUVVJBTUSNJTA-UHFFFAOYSA-N
- InChI: InChI=1S/C9H21N3/c1-3-9(8-10)12-6-4-11(2)5-7-12/h9H,3-8,10H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 171.28300 |
| Density: | 0.947g/cm3 |
| CAS: | 953739-57-6 |
| Bolling_Point: | 237.3ºC at 760 mmHg |
| Product_Name: | 2-(4-methylpiperazin-1-yl)butan-1-amine |
| Melting_Point: | N/A |
| Flash_Point: | N/A |
| MF: | C9H21N3 |
| Density: | 0.947g/cm3 |
|---|---|
| LogP: | 0.54720 |
| Refractive_Index: | 1.49 |
| FW: | 171.28300 |
| PSA: | 32.50000 |
| MF: | C9H21N3 |
| Bolling_Point: | 237.3ºC at 760 mmHg |
| Exact_Mass: | 171.17400 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933599090 |
| RIDADR: | NONH for all modes of transport |
![2-(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)acetic acid (CAS: 57153-43-2) - Related Chemical Product](/static/img/prod_pic/FT-0756307.png "2-(4-methyl-6,7-dihydrothieno[3,2-c]pyran-4-yl)acetic acid chemical structure")