![1H-Pyrrolo[3,2-b]pyridin-6-ol (CAS: 1015609-35-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678349.png "1H-Pyrrolo[3,2-b]pyridin-6-ol chemical structure")
1H-Pyrrolo[3,2-b]pyridin-6-ol
Catalog No: FT-0678349
CAS No: 1015609-35-4
- Chemical Name: 1H-Pyrrolo[3,2-b]pyridin-6-ol
- Molecular Formula: C7H6N2O
- Molecular Weight: 134.14
- InChI Key: YPBPBVINIWDVDK-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N2O/c10-5-3-7-6(9-4-5)1-2-8-7/h1-4,8,10H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 134.135 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 1015609-35-4 |
| Bolling_Point: | 369.7±22.0 °C at 760 mmHg |
| Product_Name: | 1H-Pyrrolo[3,2-b]pyridin-6-ol |
| Melting_Point: | N/A |
| Flash_Point: | 177.4±22.3 °C |
| MF: | C7H6N2O |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 0.77 |
| Flash_Point: | 177.4±22.3 °C |
| Refractive_Index: | 1.760 |
| FW: | 134.135 |
| PSA: | 48.91000 |
| MF: | C7H6N2O |
| Bolling_Point: | 369.7±22.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Exact_Mass: | 134.048019 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
