S-(2,3,4-Trihydroxybutyl)mercapturic Acid (Mixture of Diatstereomers)
Catalog No: FT-0675557
CAS No: 219965-90-9
- Chemical Name: S-(2,3,4-Trihydroxybutyl)mercapturic Acid (Mixture of Diatstereomers)
- Molecular Formula: C9H17NO6S
- Molecular Weight: 267.30
- InChI Key: QGRUOXFPDCTBCA-KKMMWDRVSA-N
- InChI: InChI=1S/C9H17NO6S/c1-5(12)10-6(9(15)16)3-17-4-8(14)7(13)2-11/h6-8,11,13-14H,2-4H2,1H3,(H,10,12)(H,15,16)/t6-,7?,8?/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (2R)-2-acetamido-3-(2,3,4-trihydroxybutylsulfanyl)propanoic acid |
|---|---|
| Flash_Point: | 371.055ºC |
| Melting_Point: | N/A |
| FW: | 267.29900 |
| Density: | 1.443g/cm3 |
| CAS: | 219965-90-9 |
| Bolling_Point: | 689.927ºC at 760 mmHg |
| MF: | C9H17NO6S |
| Density: | 1.443g/cm3 |
|---|---|
| Flash_Point: | 371.055ºC |
| Refractive_Index: | 1.577 |
| FW: | 267.29900 |
| PSA: | 152.39000 |
| MF: | C9H17NO6S |
| Bolling_Point: | 689.927ºC at 760 mmHg |
| Vapor_Pressure: | 0mmHg at 25°C |
| Exact_Mass: | 267.07800 |
Related Products
N-(2-Deoxy-a,b-D-glucopyranosyl)-S-nitroso-N-acetyl-D,L-penicillamine