3-Methylquinoxaline-2-carboxylic Acid
Catalog No: FT-0672133
CAS No: 74003-63-7
- Chemical Name: 3-Methylquinoxaline-2-carboxylic Acid
- Molecular Formula: C10H8N2O2
- Molecular Weight: 188.18
- InChI Key: BJPNADFNSANIPF-UHFFFAOYSA-N
- InChI: InChI=1S/C10H8N2O2/c1-6-9(10(13)14)12-8-5-3-2-4-7(8)11-6/h2-5H,1H3,(H,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 188.183 |
| Density: | 1.4±0.1 g/cm3 |
| CAS: | 74003-63-7 |
| Bolling_Point: | 347.1±37.0 °C at 760 mmHg |
| Product_Name: | 3-Methyl-2-quinoxalinecarboxylic acid |
| Melting_Point: | 168-170ºC |
| Flash_Point: | 163.7±26.5 °C |
| MF: | C10H8N2O2 |
| Density: | 1.4±0.1 g/cm3 |
|---|---|
| LogP: | 2.26 |
| Flash_Point: | 163.7±26.5 °C |
| Melting_Point: | 168-170ºC |
| FW: | 188.183 |
| PSA: | 63.08000 |
| Exact_Mass: | 188.058578 |
| MF: | C10H8N2O2 |
| Bolling_Point: | 347.1±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Refractive_Index: | 1.673 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933990090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)