![(1R,4S)-rel-N-[4-[(Acetyloxy)methyl]-2-cyclopenten-1-yl]acetamide (CAS: 61865-50-7) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0661331.png "(1R,4S)-rel-N-[4-[(Acetyloxy)methyl]-2-cyclopenten-1-yl]acetamide chemical structure")
(1R,4S)-rel-N-[4-[(Acetyloxy)methyl]-2-cyclopenten-1-yl]acetamide
Catalog No: FT-0661331
CAS No: 61865-50-7
- Chemical Name: (1R,4S)-rel-N-[4-[(Acetyloxy)methyl]-2-cyclopenten-1-yl]acetamide
- Molecular Formula: C10H15NO3
- Molecular Weight: 197.23
- InChI Key: NUVGPCPCBFRPHQ-ZJUUUORDSA-N
- InChI: InChI=1S/C10H15NO3/c1-7(12)11-10-4-3-9(5-10)6-14-8(2)13/h3-4,9-10H,5-6H2,1-2H3,(H,11,12)/t9-,10+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | (1R,4S)-rel-N-[4-[(Acetyloxy)methyl]-2-cyclopenten-1-yl]acetamide |
|---|---|
| Flash_Point: | N/A |
| Melting_Point: | 78-80ºC(lit.) |
| FW: | 197.23100 |
| Density: | N/A |
| CAS: | 61865-50-7 |
| Bolling_Point: | 221ºC(lit.) |
| MF: | C10H15NO3 |
| LogP: | 1.02120 |
|---|---|
| Melting_Point: | 78-80ºC(lit.) |
| FW: | 197.23100 |
| PSA: | 55.40000 |
| MF: | C10H15NO3 |
| Bolling_Point: | 221ºC(lit.) |
| Exact_Mass: | 197.10500 |
| Hazard_Codes: | Xn |
|---|---|
| RIDADR: | UN 3077 9/PG 3 |
| Risk_Statements(EU): | 40 |
| HS_Code: | 2924199090 |
| Safety_Statements: | 36/37 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)