6-Fluoro-3-(4-piperidinyl)-1,2-benzisoxazole
Catalog No: FT-0656102
CAS No: 84163-77-9
- Molecular Formula: 220.24
- Formula Weight: C12H13FN2O
- Inchl Key: MRMGJMGHPJZSAE-UHFFFAOYSA-N
- Inchl: InChI=1S/C12H13FN2O/c13-9-1-2-10-11(7-9)16-15-12(10)8-3-5-14-6-4-8/h1-2,7-8,14H,3-6H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS06 |
|---|---|
| CAS: | 84163-77-9 |
| Flash_Point: | 170.9±27.9 °C |
| Product_Name: | 6-Fluoro-3-(4-piperidinyl)-1,2-benzoxazole |
| Bolling_Point: | 359.0±42.0 °C at 760 mmHg |
| FW: | 220.243 |
| Melting_Point: | 59-62°C |
| MF: | C12H13FN2O |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.566 |
|---|---|
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Flash_Point: | 170.9±27.9 °C |
| LogP: | 1.85 |
| Bolling_Point: | 359.0±42.0 °C at 760 mmHg |
| FW: | 220.243 |
| PSA: | 38.06000 |
| Computational_Chemistry: | ['1. XlogP :2 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :N/A ', '6. TPSA 381 ', '7. Heavy Atom Count :16 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :245 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 59-62°C |
| MF: | C12H13FN2O |
| Exact_Mass: | 220.101196 |
| Density: | 1.2±0.1 g/cm3 |
| Symbol: | GHS06 |
|---|---|
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
| HS_Code: | 2934999090 |
| RTECS: | DL6425000 |
| RIDADR: | UN 2811 6.1 / PGIII |
| Hazard_Codes: | Xi |
| Warning_Statement: | P301 + P310 |
| Safety_Statements: | H301 |
