Ethyl pyrazole-3-carboxylate
Catalog No: FT-0650139
CAS No: 5932-27-4
- Chemical Name: Ethyl pyrazole-3-carboxylate
- Molecular Formula: C6H8N2O2
- Molecular Weight: 140.14
- InChI Key: MSPOSRHJXMILNK-UHFFFAOYSA-N
- InChI: InChI=1S/C6H8N2O2/c1-2-10-6(9)5-3-4-7-8-5/h3-4H,2H2,1H3,(H,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 140.140 |
|---|---|
| Bolling_Point: | 279 ºC |
| MF: | C6H8N2O2 |
| Flash_Point: | 123 ºC |
| Product_Name: | Ethyl pyrazole-3-carboxylate |
| Density: | 1.214 |
| CAS: | 5932-27-4 |
| Melting_Point: | 158-160ºC |
| Refractive_Index: | 1.522 |
|---|---|
| FW: | 140.140 |
| LogP: | 0.63 |
| Bolling_Point: | 279 ºC |
| Exact_Mass: | 140.058578 |
| Flash_Point: | 123 ºC |
| MF: | C6H8N2O2 |
| PSA: | 54.98000 |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Density: | 1.214 |
| Melting_Point: | 158-160ºC |
| RIDADR: | NONH for all modes of transport |
|---|---|
| Hazard_Codes: | Xi |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)