Cibenzoline succinate
Catalog No: FT-0623817
CAS No: 100678-32-8
- Chemical Name: Cibenzoline succinate
- Molecular Formula: C22H24N2O4
- Molecular Weight: 380.4
- InChI Key: XFUIOIWYMHEPIE-UHFFFAOYSA-N
- InChI: InChI=1S/C18H18N2.C4H6O4/c1-3-7-14(8-4-1)18(15-9-5-2-6-10-15)13-16(18)17-19-11-12-20-17;5-3(6)1-2-4(7)8/h1-10,16H,11-13H2,(H,19,20);1-2H2,(H,5,6)(H,7,8)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 380.43700 |
| Density: | N/A |
| CAS: | 100678-32-8 |
| Bolling_Point: | 449.2ºC at 760mmHg |
| Product_Name: | Cibenzoline succinate |
| Melting_Point: | N/A |
| Flash_Point: | 225.5ºC |
| MF: | C22H24N2O4 |
| LogP: | 2.69450 |
|---|---|
| Flash_Point: | 225.5ºC |
| FW: | 380.43700 |
| PSA: | 98.99000 |
| MF: | C22H24N2O4 |
| Bolling_Point: | 449.2ºC at 760mmHg |
| Vapor_Pressure: | 7.75E-08mmHg at 25°C |
| Exact_Mass: | 380.17400 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| RTECS: | EJ9960100 |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xn: Harmful; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)