Benzyloxyacetyl chloride
Catalog No: FT-0622858
CAS No: 19810-31-2
- Molecular Formula: 184.62
- Formula Weight: C9H9ClO2
- Inchl Key: QISAUDWTBBNJIR-UHFFFAOYSA-N
- Inchl: InChI=1S/C9H9ClO2/c10-9(11)7-12-6-8-4-2-1-3-5-8/h1-5H,6-7H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 19810-31-2 |
| Flash_Point: | 96.4±20.8 °C |
| Product_Name: | 2-(Benzyloxy)acetyl chloride |
| Bolling_Point: | 282.3±0.0 °C at 760 mmHg |
| FW: | 184.620 |
| Melting_Point: | N/A |
| MF: | C9H9ClO2 |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.525 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 96.4±20.8 °C |
| LogP: | 2.51 |
| Bolling_Point: | 282.3±0.0 °C at 760 mmHg |
| FW: | 184.620 |
| PSA: | 26.30000 |
| Computational_Chemistry: | ['1. XlogP :22 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :N/A ', '6. TPSA 263 ', '7. Heavy Atom Count :12 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :142 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C9H9ClO2 |
| Exact_Mass: | 184.029114 |
| Molecular_Structure: | ['五分子性质数据 ', '1 . Molar refractive index 4705 ', '2 . Molar volume (m3/mol)1536 ', '3 . Parachor (902K)3868 ', '4 表面张力(dyne/cm)402 ', '5 . Polarizability (10-24cm3)1865'] |
| Density: | 1.2±0.1 g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）117 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）84-87°C04mm Hg(lit) ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index1523 ', '8. Flash point（ºC）>230°F ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS05 |
|---|---|
| Supplementary_Hazard_Statement: | Reacts violently with water. |
| RIDADR: | UN 3265 8/PG 2 |
| HS_Code: | 2918990090 |
| Packing_Group: | III |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R14;R34 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Codes: | C:Corrosive; |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314 |
