7-CHLOROISATIN
Catalog No: FT-0621373
CAS No: 7477-63-6
- Chemical Name: 7-CHLOROISATIN
- Molecular Formula: C8H4ClNO2
- Molecular Weight: 181.57
- InChI Key: MPLXQMMMGDYXIT-UHFFFAOYSA-N
- InChI: InChI=1S/C8H4ClNO2/c9-5-3-1-2-4-6(5)10-8(12)7(4)11/h1-3H,(H,10,11,12)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 7-Chloroisatin |
|---|---|
| Bolling_Point: | N/A |
| MF: | C8H4ClNO2 |
| Symbol: | GHS07 |
| Melting_Point: | 187-191ºC |
| CAS: | 7477-63-6 |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 181.576 |
| Flash_Point: | N/A |
| Exact_Mass: | 180.993057 |
|---|---|
| MF: | C8H4ClNO2 |
| Refractive_Index: | 1.626 |
| Density: | 1.5±0.1 g/cm3 |
| PSA: | 46.17000 |
| FW: | 181.576 |
| LogP: | 1.07 |
| Melting_Point: | 187-191ºC |
| Risk_Statements(EU): | R22 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Safety_Statements: | H302-H315-H319-H335 |
| HS_Code: | 2933990090 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Hazard_Codes: | Xn: Harmful;Xi: Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)