M-CYANOBENZYL CHLORIDE
Catalog No: FT-0615492
CAS No: 64407-07-4
- Molecular Formula: 151.59
- Formula Weight: C8H6ClN
- Inchl Key: WRXVOTDGLNPNND-UHFFFAOYSA-N
- Inchl: InChI=1S/C8H6ClN/c9-5-7-2-1-3-8(4-7)6-10/h1-4H,5H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 64407-07-4 |
| Flash_Point: | 111.4±15.4 °C |
| Product_Name: | 3-Cyanobenzylchloride |
| Bolling_Point: | 259.0±15.0 °C at 760 mmHg |
| FW: | 151.593 |
| Melting_Point: | N/A |
| MF: | C8H6ClN |
| Density: | 1.2±0.1 g/cm3 |
| Refractive_Index: | 1.551 |
|---|---|
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| MF: | C8H6ClN |
| Flash_Point: | 111.4±15.4 °C |
| LogP: | 1.92 |
| FW: | 151.593 |
| Density: | 1.2±0.1 g/cm3 |
| PSA: | 23.79000 |
| Bolling_Point: | 259.0±15.0 °C at 760 mmHg |
| Exact_Mass: | 151.018875 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2926909090 |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)