3-(2-METHYL-1,3-THIAZOL-4-YL)ANILINE
Catalog No: FT-0613567
CAS No: 89250-34-0
- Chemical Name: 3-(2-METHYL-1,3-THIAZOL-4-YL)ANILINE
- Molecular Formula: C10H10N2S
- Molecular Weight: 190.27
- InChI Key: CPHZPWZSSBCSAH-UHFFFAOYSA-N
- InChI: InChI=1S/C10H10N2S/c1-7-12-10(6-13-7)8-3-2-4-9(11)5-8/h2-6H,11H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 190.26500 |
|---|---|
| CAS: | 89250-34-0 |
| Flash_Point: | 184ºC |
| MF: | C10H10N2S |
| Symbol: | Danger |
| Bolling_Point: | 380.6ºC at 760 mmHg |
| Melting_Point: | 102-106ºC(lit.) |
| Product_Name: | 3-(2-methyl-1,3-thiazol-4-yl)aniline |
| Density: | 1.219g/cm3 |
| FW: | 190.26500 |
|---|---|
| MF: | C10H10N2S |
| Exact_Mass: | 190.05600 |
| Flash_Point: | 184ºC |
| LogP: | 3.28190 |
| PSA: | 67.15000 |
| Refractive_Index: | 1.642 |
| Bolling_Point: | 380.6ºC at 760 mmHg |
| Melting_Point: | 102-106ºC(lit.) |
| Density: | 1.219g/cm3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Symbol: | GHS05, GHS07 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H318-H335 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22 |
| Hazard_Codes: | Xn: Harmful;Xi: Irritant; |
| HS_Code: | 2934100090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)