2-(1H-PYRAZOL-1-YL)ANILINE
Catalog No: FT-0608371
CAS No: 54705-91-8
- Chemical Name: 2-(1H-PYRAZOL-1-YL)ANILINE
- Molecular Formula: C9H9N3
- Molecular Weight: 159.19
- InChI Key: UIYKQBXRFZCXFX-UHFFFAOYSA-N
- InChI: InChI=1S/C9H9N3/c10-8-4-1-2-5-9(8)12-7-3-6-11-12/h1-7H,10H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(1H-Pyrazol-1-yl)aniline |
|---|---|
| Flash_Point: | 138.5±20.4 °C |
| Melting_Point: | 44-46ºC |
| FW: | 159.188 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 54705-91-8 |
| Bolling_Point: | 305.4±15.0 °C at 760 mmHg |
| MF: | C9H9N3 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 1.27 |
| Flash_Point: | 138.5±20.4 °C |
| Melting_Point: | 44-46ºC |
| FW: | 159.188 |
| PSA: | 43.84000 |
| Exact_Mass: | 159.079651 |
| MF: | C9H9N3 |
| Bolling_Point: | 305.4±15.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Refractive_Index: | 1.641 |
| Hazard_Codes: | Xi |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933199090 |
| Safety_Statements: | S26-S37/39 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)