Hyperoside
Catalog No: FT-0603413
CAS No: 482-36-0
- Chemical Name: Hyperoside
- Molecular Formula: C21H20O12
- Molecular Weight: 464.4
- InChI Key: OVSQVDMCBVZWGM-DTGCRPNFSA-N
- InChI: InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15+,17+,18-,21+/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | Hyperoside |
|---|---|
| Bolling_Point: | 872.6±65.0 °C at 760 mmHg |
| MF: | C21H20O12 |
| Symbol: | GHS07 |
| Melting_Point: | 225-226ºC |
| CAS: | 482-36-0 |
| Density: | 1.9±0.1 g/cm3 |
| FW: | 464.376 |
| Flash_Point: | 307.5±27.8 °C |
| Vapor_Pressure: | 0.0±0.3 mmHg at 25°C |
|---|---|
| Exact_Mass: | 464.095490 |
| Refractive_Index: | 1.803 |
| LogP: | 1.75 |
| Bolling_Point: | 872.6±65.0 °C at 760 mmHg |
| Density: | 1.9±0.1 g/cm3 |
| MF: | C21H20O12 |
| PSA: | 210.51000 |
| FW: | 464.376 |
| Flash_Point: | 307.5±27.8 °C |
| Melting_Point: | 225-226ºC |
| Risk_Statements(EU): | R22 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard_Codes: | Xn:Harmful; |
| RTECS: | DJ3009200 |
| Safety_Statements: | 22-45 |
| WGK_Germany: | 3 |
| Warning_Statement: | P301 + P312 + P330 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)