5-Ethylthiophenylboronic acid
Catalog No: FT-0602256
CAS No: 870718-05-1
- Chemical Name: 5-Ethylthiophenylboronic acid
- Molecular Formula: C8H11BO2S
- Molecular Weight: 182.05
- InChI Key: CZODYJDCHKOBID-UHFFFAOYSA-N
- InChI: InChI=1S/C8H11BO2S/c1-2-12-8-5-3-4-7(6-8)9(10)11/h3-6,10-11H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 3-Ethylthiophenylboronic acid |
|---|---|
| Flash_Point: | 166.5ºC |
| Melting_Point: | 118-122ºC(lit.) |
| FW: | 182.04800 |
| Density: | 1.18g/cm3 |
| CAS: | 870718-05-1 |
| Bolling_Point: | 351.7ºC at 760 mmHg |
| MF: | C8H11BO2S |
| Density: | 1.18g/cm3 |
|---|---|
| LogP: | 0.47840 |
| Flash_Point: | 166.5ºC |
| Melting_Point: | 118-122ºC(lit.) |
| FW: | 182.04800 |
| PSA: | 65.76000 |
| Exact_Mass: | 182.05700 |
| MF: | C8H11BO2S |
| Bolling_Point: | 351.7ºC at 760 mmHg |
| Refractive_Index: | 1.571 |
| Hazard_Codes: | F,Xi |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R11 |
| HS_Code: | 2931900090 |
| Safety_Statements: | 7/9-16-29-33 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)