Clofarabine
Catalog No: FT-0601617
CAS No: 123318-82-1
- Molecular Formula: 303.68
- Formula Weight: C10H11ClFN5O3
- Inchl Key: WDDPHFBMKLOVOX-AYQXTPAHSA-N
- Inchl: InChI=1S/C10H11ClFN5O3/c11-10-15-7(13)5-8(16-10)17(2-14-5)9-4(12)6(19)3(1-18)20-9/h2-4,6,9,18-19H,1H2,(H2,13,15,16)/t3-,4+,6-,9-/m1/s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS06 |
|---|---|
| CAS: | 123318-82-1 |
| Flash_Point: | 316.4±32.9 °C |
| Product_Name: | Clofarabine |
| Bolling_Point: | 599.5±60.0 °C at 760 mmHg |
| FW: | 303.677 |
| Melting_Point: | 228-2310C |
| MF: | C10H11ClFN5O3 |
| Density: | 2.1±0.1 g/cm3 |
| Refractive_Index: | 1.844 |
|---|---|
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| Flash_Point: | 316.4±32.9 °C |
| LogP: | 0.24 |
| Bolling_Point: | 599.5±60.0 °C at 760 mmHg |
| FW: | 303.677 |
| PSA: | 119.31000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :3 ', '3. Hydrogen Bond Acceptor Count :8 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :3 ', '6. TPSA 119 ', '7. Heavy Atom Count :20 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :370 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :4 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 228-2310C |
| MF: | C10H11ClFN5O3 |
| Exact_Mass: | 303.053436 |
| Density: | 2.1±0.1 g/cm3 |
| More_Info: | ['1. Appearance 灰White 粉末状Solid 。'] |
| Symbol: | GHS06 |
|---|---|
| RIDADR: | UN 2735 8/PG 3 |
| Packing_Group: | III |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| RTECS: | DP5550000 |
| Hazard_Codes: | Xi,C |
| Warning_Statement: | P264-P301 + P310 |
| Safety_Statements: | H300 |
Related Products
(5E)-5-(3-Ethoxy-2-hydroxybenzylidene)-2-mercapto-1,3-thiazol-4(5H)-one
