![3-Iodo-5-methoxy-1H-pyrrolo[3,2-b]pyridine (CAS: 913983-30-9) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0678335.png "3-Iodo-5-methoxy-1H-pyrrolo[3,2-b]pyridine chemical structure")
3-Iodo-5-methoxy-1H-pyrrolo[3,2-b]pyridine
Catalog No: FT-0678335
CAS No: 913983-30-9
- Chemical Name: 3-Iodo-5-methoxy-1H-pyrrolo[3,2-b]pyridine
- Molecular Formula: C8H7IN2O
- Molecular Weight: 274.06
- InChI Key: IQHSOIXTQSRBLZ-UHFFFAOYSA-N
- InChI: InChI=1S/C8H7IN2O/c1-12-7-3-2-6-8(11-7)5(9)4-10-6/h2-4,10H,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 274.059 |
| Density: | 1.9±0.1 g/cm3 |
| CAS: | 913983-30-9 |
| Bolling_Point: | 366.9±37.0 °C at 760 mmHg |
| Product_Name: | 3-Iodo-5-methoxy-1H-pyrrolo[3,2-b]pyridine |
| Melting_Point: | N/A |
| Flash_Point: | 175.7±26.5 °C |
| MF: | C8H7IN2O |
| Density: | 1.9±0.1 g/cm3 |
|---|---|
| LogP: | 1.93 |
| Flash_Point: | 175.7±26.5 °C |
| Refractive_Index: | 1.728 |
| FW: | 274.059 |
| PSA: | 37.91000 |
| MF: | C8H7IN2O |
| Bolling_Point: | 366.9±37.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.8 mmHg at 25°C |
| Exact_Mass: | 273.960297 |
| Hazard_Codes: | Xi |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
| RIDADR: | NONH for all modes of transport |
