3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE
Catalog No: FT-0604335
CAS No: 78583-81-0
- Chemical Name: 3-(4-CHLOROPHENYL)-1H-PYRAZOL-5-AMINE
- Molecular Formula: C9H8ClN3
- Molecular Weight: 193.63
- InChI Key: XQPBZIITFQHIDI-UHFFFAOYSA-N
- InChI: InChI=1S/C9H8ClN3/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,(H3,11,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Danger |
|---|---|
| FW: | 193.63300 |
| Density: | 1.378g/cm3 |
| CAS: | 78583-81-0 |
| Bolling_Point: | 463.8ºC at 760 mmHg |
| Product_Name: | 5-(4-Chlorophenyl)-1H-pyrazol-3-amine |
| Melting_Point: | 172-176ºC(lit.) |
| Flash_Point: | 234.3ºC |
| MF: | C9H8ClN3 |
| Density: | 1.378g/cm3 |
|---|---|
| LogP: | 2.89350 |
| Flash_Point: | 234.3ºC |
| Melting_Point: | 172-176ºC(lit.) |
| FW: | 193.63300 |
| PSA: | 54.70000 |
| Exact_Mass: | 193.04100 |
| MF: | C9H8ClN3 |
| Bolling_Point: | 463.8ºC at 760 mmHg |
| Refractive_Index: | 1.67 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
|---|---|
| Hazard_Codes: | Xn: Harmful;Xi: Irritant; |
| Risk_Statements(EU): | R22 |
| Safety_Statements: | 26-36 |
| Symbol: | Danger |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)