1-METHYL-1H-PYRAZOL-4-YLAMINE
Catalog No: FT-0647247
CAS No: 69843-13-6
- Chemical Name: 1-METHYL-1H-PYRAZOL-4-YLAMINE
- Molecular Formula: C4H7N3
- Molecular Weight: 97.12
- InChI Key: LBGSWBJURUFGLR-UHFFFAOYSA-N
- InChI: InChI=1S/C4H7N3/c1-7-3-4(5)2-6-7/h2-3H,5H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 97.118 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 69843-13-6 |
| Bolling_Point: | 231.4±13.0 °C at 760 mmHg |
| Product_Name: | 1-Methyl-1H-pyrazol-4-ylamine |
| Melting_Point: | N/A |
| Flash_Point: | 93.8±19.8 °C |
| MF: | C4H7N3 |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | -0.68 |
| Flash_Point: | 93.8±19.8 °C |
| Refractive_Index: | 1.601 |
| FW: | 97.118 |
| PSA: | 43.84000 |
| MF: | C4H7N3 |
| Bolling_Point: | 231.4±13.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.1±0.5 mmHg at 25°C |
| Exact_Mass: | 97.063995 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P305 + P351 + P338 |
| Safety_Statements: | H315-H319 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)