![[1-(4-chlorophenyl)cyclopropyl]methanamine (CAS: 69385-29-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0752922.png "[1-(4-chlorophenyl)cyclopropyl]methanamine chemical structure")
[1-(4-chlorophenyl)cyclopropyl]methanamine
Catalog No: FT-0752922
CAS No: 69385-29-1
- Chemical Name: [1-(4-chlorophenyl)cyclopropyl]methanamine
- Molecular Formula: C10H12ClN
- Molecular Weight: 181.66
- InChI Key: VXHKUEKHNVGRTP-UHFFFAOYSA-N
- InChI: InChI=1S/C10H12ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-7,12H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 69385-29-1 |
|---|---|
| MF: | C10H12ClN |
| Density: | 1.2±0.1 g/cm3 |
| Flash_Point: | 136.2±10.7 °C |
| Melting_Point: | N/A |
| Product_Name: | 1-[1-(4-Chlorophenyl)cyclopropyl]methanamine |
| Symbol: | GHS07 |
| Bolling_Point: | 266.5±23.0 °C at 760 mmHg |
| FW: | 181.662 |
| Bolling_Point: | 266.5±23.0 °C at 760 mmHg |
|---|---|
| Density: | 1.2±0.1 g/cm3 |
| MF: | C10H12ClN |
| LogP: | 2.38 |
| Exact_Mass: | 181.065826 |
| Vapor_Pressure: | 0.0±0.5 mmHg at 25°C |
| Flash_Point: | 136.2±10.7 °C |
| FW: | 181.662 |
| Refractive_Index: | 1.588 |
| PSA: | 26.02000 |
| Safety_Statements: | H319 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P305 + P351 + P338 |
| HS_Code: | 2921499090 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
