1-(5-methylthiophen-2-yl)propan-1-one
Catalog No: FT-0707291
CAS No: 59303-13-8
- Chemical Name: 1-(5-methylthiophen-2-yl)propan-1-one
- Molecular Formula: C8H10OS
- Molecular Weight: 154.23
- InChI Key: ROPOMQPSWIOWSN-UHFFFAOYSA-N
- InChI: InChI=1S/C8H10OS/c1-3-7(9)8-5-4-6(2)10-8/h4-5H,3H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 59303-13-8 |
|---|---|
| MF: | C8H10OS |
| Density: | 1.076g/cm3 |
| Flash_Point: | 105.7ºC |
| Melting_Point: | N/A |
| Product_Name: | 1-(5-methylthiophen-2-yl)propan-1-one |
| Symbol: | GHS07 |
| Bolling_Point: | 251.1ºC at 760 mmHg |
| FW: | 154.22900 |
| Density: | 1.076g/cm3 |
|---|---|
| MF: | C8H10OS |
| LogP: | 2.64920 |
| Exact_Mass: | 154.04500 |
| Bolling_Point: | 251.1ºC at 760 mmHg |
| Flash_Point: | 105.7ºC |
| FW: | 154.22900 |
| Refractive_Index: | 1.528 |
| PSA: | 45.31000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)