2-BROMOTRIDECANE
Catalog No: FT-0640585
CAS No: 59157-17-4
- Chemical Name: 2-BROMOTRIDECANE
- Molecular Formula: C13H27Br
- Molecular Weight: 263.26 g/mol
- InChI Key: XNCUZDYTCKIDEJ-UHFFFAOYSA-N
- InChI: InChI=1S/C13H27Br/c1-3-4-5-6-7-8-9-10-11-12-13(2)14/h13H,3-12H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 289.8ºC at 760 mmHg |
|---|---|
| MF: | C13H27Br |
| Density: | 1.025g/cm3 |
| FW: | 263.25700 |
| Product_Name: | 2-bromotridecane |
| CAS: | 59157-17-4 |
| Flash_Point: | 90ºC |
| Melting_Point: | N/A |
| Bolling_Point: | 289.8ºC at 760 mmHg |
|---|---|
| MF: | C13H27Br |
| Density: | 1.025g/cm3 |
| Refractive_Index: | 1.457 |
| Exact_Mass: | 262.13000 |
| LogP: | 5.69070 |
| Flash_Point: | 90ºC |
| FW: | 263.25700 |
| HS_Code: | 2903399090 |
|---|
Related Products
Silicic acid,sodium salt,reaction products with chlorotrimethylsilane and iso-Pr alc.