![1,3-dibromo-5-octylthieno[3,4-c]pyrrole-4,6-dione (CAS: 566939-58-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0762347.png "1,3-dibromo-5-octylthieno[3,4-c]pyrrole-4,6-dione chemical structure")
1,3-dibromo-5-octylthieno[3,4-c]pyrrole-4,6-dione
Catalog No: FT-0762347
CAS No: 566939-58-0
- Chemical Name: 1,3-dibromo-5-octylthieno[3,4-c]pyrrole-4,6-dione
- Molecular Formula: C14H17Br2NO2S
- Molecular Weight: 423.2
- InChI Key: GSGMEQUXTCYOAU-UHFFFAOYSA-N
- InChI: InChI=1S/C14H17Br2NO2S/c1-2-3-4-5-6-7-8-17-13(18)9-10(14(17)19)12(16)20-11(9)15/h2-8H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 566939-58-0 |
|---|---|
| MF: | C14H17Br2NO2S |
| Density: | 1.6±0.1 g/cm3 |
| Flash_Point: | 230.7±28.7 °C |
| Melting_Point: | N/A |
| Product_Name: | 1,3-Dibromo-5-octyl-4H-thieno[3,4-c]pyrrole-4,6(5H)-dione |
| Symbol: | GHS07 |
| Bolling_Point: | 457.8±45.0 °C at 760 mmHg |
| FW: | 423.163 |
| Bolling_Point: | 457.8±45.0 °C at 760 mmHg |
|---|---|
| Density: | 1.6±0.1 g/cm3 |
| MF: | C14H17Br2NO2S |
| LogP: | 6.61 |
| Exact_Mass: | 420.934662 |
| Vapor_Pressure: | 0.0±1.1 mmHg at 25°C |
| Flash_Point: | 230.7±28.7 °C |
| FW: | 423.163 |
| Refractive_Index: | 1.594 |
| PSA: | 65.62000 |
| Safety_Statements: | H315-H319-H335 |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-