4-aminobenzenecarbothioamide
Catalog No: FT-0692408
CAS No: 4714-67-4
- Molecular Formula: 152.22
- Formula Weight: C7H8N2S
- Inchl Key: LZJVSPPXXGXGQL-UHFFFAOYSA-N
- Inchl: InChI=1S/C7H8N2S/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,8H2,(H2,9,10)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-Aminobenzenecarbothioamide |
|---|---|
| Bolling_Point: | 325.6±44.0 °C at 760 mmHg |
| MF: | C7H8N2S |
| Symbol: | GHS07 |
| Melting_Point: | 182ºC |
| CAS: | 4714-67-4 |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 152.217 |
| Flash_Point: | 150.7±28.4 °C |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
|---|---|
| Exact_Mass: | 152.040817 |
| Refractive_Index: | 1.719 |
| LogP: | 0.73 |
| Bolling_Point: | 325.6±44.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| MF: | C7H8N2S |
| PSA: | 84.13000 |
| FW: | 152.217 |
| Flash_Point: | 150.7±28.4 °C |
| Melting_Point: | 182ºC |
| Risk_Statements(EU): | 36/37/38 |
|---|---|
| Hazard_Codes: | Xi |
| HS_Code: | 2930909090 |
| Safety_Statements: | 26-36/37/39 |
| Warning_Statement: | P280-P305 + P351 + P338 |
| Symbol: | GHS07 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)