4-Chloro-3-iodo-pyridin-2-ylamine
Catalog No: FT-0678314
CAS No: 417721-69-8
- Chemical Name: 4-Chloro-3-iodo-pyridin-2-ylamine
- Molecular Formula: C5H4ClIN2
- Molecular Weight: 254.45
- InChI Key: BWMULFKDCVPGNF-UHFFFAOYSA-N
- InChI: InChI=1S/C5H4ClIN2/c6-3-1-2-9-5(8)4(3)7/h1-2H,(H2,8,9)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 254.456 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 417721-69-8 |
| Bolling_Point: | 319.8±42.0 °C at 760 mmHg |
| Product_Name: | 2-Amino-4-chloro-3-iodopyridine |
| Melting_Point: | N/A |
| Flash_Point: | 147.2±27.9 °C |
| MF: | C5H4ClIN2 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 3.01 |
| Flash_Point: | 147.2±27.9 °C |
| Refractive_Index: | 1.708 |
| FW: | 254.456 |
| PSA: | 38.91000 |
| MF: | C5H4ClIN2 |
| Bolling_Point: | 319.8±42.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Exact_Mass: | 253.910767 |
| Hazard_Codes: | Xi |
|---|---|
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Safety_Statements: | H302 + H312 + H332-H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)