2-ETHYL-4-FLUOROPHENOL
Catalog No: FT-0612248
CAS No: 398-71-0
- Chemical Name: 2-ETHYL-4-FLUOROPHENOL
- Molecular Formula: C8H9FO
- Molecular Weight: 140.15
- InChI Key: JKZWRPGOAAMNQY-UHFFFAOYSA-N
- InChI: InChI=1S/C8H9FO/c1-2-6-5-7(9)3-4-8(6)10/h3-5,10H,2H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 140.15500 |
| Density: | 1.122 g/cm3 |
| CAS: | 398-71-0 |
| Bolling_Point: | 162ºC |
| Product_Name: | 2-ethyl-4-fluorophenol |
| Melting_Point: | N/A |
| Flash_Point: | 91.7ºC |
| MF: | C8H9FO |
| Density: | 1.122 g/cm3 |
|---|---|
| LogP: | 2.09370 |
| Flash_Point: | 91.7ºC |
| Refractive_Index: | 1.515 |
| FW: | 140.15500 |
| PSA: | 20.23000 |
| MF: | C8H9FO |
| Bolling_Point: | 162ºC |
| Exact_Mass: | 140.06400 |
| Hazard_Codes: | Xi |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2908199090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)