2,4-Difluoropyridine
Catalog No: FT-0600158
CAS No: 34941-90-7
- Chemical Name: 2,4-Difluoropyridine
- Molecular Formula: C5H3F2N
- Molecular Weight: 115.08
- InChI Key: WLAKUAILRGATSL-UHFFFAOYSA-N
- InChI: InChI=1S/C5H3F2N/c6-4-1-2-8-5(7)3-4/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2,4-Difluoropyridine |
|---|---|
| Flash_Point: | 27.8±21.8 °C |
| Melting_Point: | N/A |
| FW: | 115.081 |
| Density: | 1.3±0.1 g/cm3 |
| CAS: | 34941-90-7 |
| Bolling_Point: | 122.4±20.0 °C at 760 mmHg |
| MF: | C5H3F2N |
| Density: | 1.3±0.1 g/cm3 |
|---|---|
| LogP: | 0.83 |
| Flash_Point: | 27.8±21.8 °C |
| Refractive_Index: | 1.447 |
| FW: | 115.081 |
| PSA: | 12.89000 |
| MF: | C5H3F2N |
| Bolling_Point: | 122.4±20.0 °C at 760 mmHg |
| Vapor_Pressure: | 16.8±0.2 mmHg at 25°C |
| Exact_Mass: | 115.023354 |
| Hazard_Codes: | Xi: Irritant;F: Flammable; |
|---|---|
| HS_Code: | 2933399090 |
Related Products
methyl 3-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate
Benzofuran,polymer with ethenylbenzene and (1-methylethenyl)benzene (9CI)
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridin-3-ylacetic acid