4-Chloro-2-nitrobenzonitrile
Catalog No: FT-0601036
CAS No: 34662-32-3
- Chemical Name: 4-Chloro-2-nitrobenzonitrile
- Molecular Formula: C7H3ClN2O2
- Molecular Weight: 182.56
- InChI Key: OZKOAADVLVCNFO-UHFFFAOYSA-N
- InChI: InChI=1S/C7H3ClN2O2/c8-6-2-1-5(4-9)7(3-6)10(11)12/h1-3H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 34662-32-3 |
| Flash_Point: | 143.4±23.7 °C |
| Product_Name: | 4-Chloro-2-nitrobenzonitrile |
| Bolling_Point: | 313.5±27.0 °C at 760 mmHg |
| FW: | 182.564 |
| Melting_Point: | 99-101ºC |
| MF: | C7H3ClN2O2 |
| Density: | 1.5±0.1 g/cm3 |
| Refractive_Index: | 1.599 |
|---|---|
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Flash_Point: | 143.4±23.7 °C |
| LogP: | 1.97 |
| Bolling_Point: | 313.5±27.0 °C at 760 mmHg |
| FW: | 182.564 |
| PSA: | 69.61000 |
| Melting_Point: | 99-101ºC |
| MF: | C7H3ClN2O2 |
| Exact_Mass: | 181.988312 |
| Density: | 1.5±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2926909090 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)