4-Methylnicotinic acid
Catalog No: FT-0600278
CAS No: 3222-50-2
- Chemical Name: 4-Methylnicotinic acid
- Molecular Formula: C7H7NO2
- Molecular Weight: 137.14
- InChI Key: ZKUZSTXNVMIDCY-UHFFFAOYSA-N
- InChI: InChI=1S/C7H7NO2/c1-5-2-3-8-4-6(5)7(9)10/h2-4H,1H3,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 3222-50-2 |
| Flash_Point: | 137.7±22.3 °C |
| Product_Name: | 4-Methylnicotinic acid |
| Bolling_Point: | 304.1±22.0 °C at 760 mmHg |
| FW: | 137.136 |
| Melting_Point: | 217-221ºC |
| MF: | C7H7NO2 |
| Density: | 1.2±0.1 g/cm3 |
| Melting_Point: | 217-221ºC |
|---|---|
| Refractive_Index: | 1.561 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C7H7NO2 |
| Flash_Point: | 137.7±22.3 °C |
| LogP: | 0.61 |
| FW: | 137.136 |
| Density: | 1.2±0.1 g/cm3 |
| PSA: | 50.19000 |
| Bolling_Point: | 304.1±22.0 °C at 760 mmHg |
| Exact_Mass: | 137.047684 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2933399090 |
| WGK_Germany: | 3 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)