5,6,7,8-tetrahydro-1H-quinoxalin-2-one
Catalog No: FT-0746503
CAS No: 27579-58-4
- Chemical Name: 5,6,7,8-tetrahydro-1H-quinoxalin-2-one
- Molecular Formula: C8H10N2O
- Molecular Weight: 150.18 g/mol
- InChI Key: LSGFRZKZEUUPIP-UHFFFAOYSA-N
- InChI: InChI=1S/C8H10N2O/c11-8-5-9-6-3-1-2-4-7(6)10-8/h5H,1-4H2,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 449.9ºC at 760 mmHg |
|---|---|
| CAS: | 27579-58-4 |
| MF: | C8H10N2O |
| Density: | 1.35g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 5,6,7,8-tetrahydro-1H-quinoxalin-2-one |
| Flash_Point: | 225.9ºC |
| FW: | 150.17800 |
| Bolling_Point: | 449.9ºC at 760 mmHg |
|---|---|
| Density: | 1.35g/cm3 |
| MF: | C8H10N2O |
| LogP: | 0.64870 |
| Exact_Mass: | 150.07900 |
| Vapor_Pressure: | 1.04E-08mmHg at 25°C |
| Flash_Point: | 225.9ºC |
| FW: | 150.17800 |
| Refractive_Index: | 1.666 |
| PSA: | 45.75000 |
| HS_Code: | 2933990090 |
|---|
Related Products
methyl (2Z)-2-(dimethylaminomethylidene)-4-methoxy-3-oxobutanoate
N-[S-Methanethiosulfonylcystaminyl]diethylenetriaminepentaacetic Acid, Monoamide (2:1 mixture of penta-acid to monoamide; approximately 30%)