4-Bromo-N-methylbenzamide
Catalog No: FT-0683451
CAS No: 27466-83-7
- Chemical Name: 4-Bromo-N-methylbenzamide
- Molecular Formula: C8H8BrNO
- Molecular Weight: 214.06 g/mol
- InChI Key: DXCFWNVWQTYPOC-UHFFFAOYSA-N
- InChI: InChI=1S/C8H8BrNO/c1-10-8(11)6-2-4-7(9)5-3-6/h2-5H,1H3,(H,10,11)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 214.059 |
|---|---|
| CAS: | 27466-83-7 |
| Melting_Point: | N/A |
| Bolling_Point: | 329.8±25.0 °C at 760 mmHg |
| MF: | C8H8BrNO |
| Product_Name: | 4-Bromo-N-methylbenzamide |
| Flash_Point: | 153.3±23.2 °C |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 214.059 |
|---|---|
| MF: | C8H8BrNO |
| Exact_Mass: | 212.978912 |
| Bolling_Point: | 329.8±25.0 °C at 760 mmHg |
| Refractive_Index: | 1.565 |
| PSA: | 29.10000 |
| LogP: | 1.80 |
| Flash_Point: | 153.3±23.2 °C |
| Density: | 1.5±0.1 g/cm3 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| HS_Code: | 2924299090 |
Related Products
Silicic acid,sodium salt,reaction products with chlorotrimethylsilane and iso-Pr alc.