(1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine
Catalog No: FT-0773784
CAS No: 23294-41-9
- Chemical Name: (1R)-1-phenyl-N-[(1R)-1-phenylethyl]ethanamine
- Molecular Formula: C16H19N
- Molecular Weight: 225.33
- InChI Key: NXLACVVNHYIYJN-ZIAGYGMSSA-N
- InChI: InChI=1S/C16H19N/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16/h3-14,17H,1-2H3/t13-,14-/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 23294-41-9 |
|---|---|
| MF: | C16H19N |
| Density: | 0.985 |
| Flash_Point: | 113ºC |
| Melting_Point: | -260ºC |
| Product_Name: | (+)-Bis[(R)-1-phenylethyl]amine |
| Symbol: | GHS07 |
| Bolling_Point: | 86ºC (0.05 mmHg) |
| FW: | 225.32900 |
| MF: | C16H19N |
|---|---|
| Density: | 0.985 |
| Computational_Chemistry: | ['1. XlogP :36 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :4 ', '5. Isotope Atom Count :N/A ', '6. TPSA 12 ', '7. Heavy Atom Count :17 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :180 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :2 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| More_Info: | ['1. Appearance Unknow ', '2. Density(g/mL,25/4℃)0985 ', '3. Relative vapor density(g/mL,Atmosphere =1)Unknow ', '4. Melting point(ºC)260 ', '5. Boiling point(ºC,Atmospheric pressure)86°C005mm Hg(lit) ', '6. Boiling point(ºC,52kPa)Unknow ', '7. Refractive index 15523 ', '8. Flash point(ºC) >230°F ', '9. Specific rotation(º)Unknow ', '10. Spontaneous ignition point or ignition temperature(ºC)Unknow ', '11. Vapor pressure(kPa,25ºC)Unknow ', '12. Saturated vapor pressure(kPa,60ºC)Unknow ', '13. Combustion heat(KJ/mol)Unknow ', '14. Critical temperature(ºC)Unknow ', '15. Critical pressure(KPa)Unknow ', '16. Oil-water(Octanol /Water )Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion(%,V/V)Unknow ', '18. Lower limit of explosion(%,V/V)Unknow ', '19. Solubility Unknow'] |
| Exact_Mass: | 225.15200 |
| Vapor_Pressure: | 0.00143mmHg at 25°C |
| Flash_Point: | 113ºC |
| PSA: | 12.03000 |
| Molecular_Structure: | ['1 . Molar refractive index 7315 ', '2 . Molar volume 2262 ', '3 . Parachor (902K)5608 ', '4 表面张力(dyne/cm)377 ', '5 . Polarizability (10-24cm3)2900'] |
| LogP: | 4.48930 |
| Bolling_Point: | 86ºC (0.05 mmHg) |
| FW: | 225.32900 |
| Refractive_Index: | 1.5523 |
| Melting_Point: | -260ºC |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | S26-S36/37 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi:Irritant; |
| HS_Code: | 2921499090 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R36/37/38 |