4-phenylthiophene-2-carboxylic acid
Catalog No: FT-0765116
CAS No: 21676-88-0
- Chemical Name: 4-phenylthiophene-2-carboxylic acid
- Molecular Formula: C11H8O2S
- Molecular Weight: 204.25
- InChI Key: DOAFBJFYWLESRS-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8O2S/c12-11(13)10-6-9(7-14-10)8-4-2-1-3-5-8/h1-7H,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 364.2ºC at 760mmHg |
|---|---|
| Symbol: | GHS07 |
| MF: | C11H8O2S |
| Melting_Point: | 168-170ºC |
| Flash_Point: | 174.1ºC |
| Product_Name: | 4-phenylthiophene-2-carboxylic acid |
| FW: | 204.24500 |
| CAS: | 21676-88-0 |
| Density: | N/A |
| Refractive_Index: | 1.635 |
|---|---|
| PSA: | 65.54000 |
| Bolling_Point: | 364.2ºC at 760mmHg |
| Flash_Point: | 174.1ºC |
| FW: | 204.24500 |
| LogP: | 3.11330 |
| Exact_Mass: | 204.02500 |
| MF: | C11H8O2S |
| Melting_Point: | 168-170ºC |
| Vapor_Pressure: | 6.06E-06mmHg at 25°C |
| Safety_Statements: | 26 |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xn: Harmful; |
| Symbol: | GHS07 |
| HS_Code: | 2934999090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Risk_Statements(EU): | R22;R36/37/38 |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)