2,3-Dibromo-1,4-butanediol
Catalog No: FT-0659513
CAS No: 1947-58-6
- Chemical Name: 2,3-Dibromo-1,4-butanediol
- Molecular Formula: C4H8Br2O2
- Molecular Weight: 247.91
- InChI Key: OXYNQEOLHRWEPE-UHFFFAOYSA-N
- InChI: InChI=1S/C4H8Br2O2/c5-3(1-7)4(6)2-8/h3-4,7-8H,1-2H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 247.913 |
| Density: | 2.1±0.1 g/cm3 |
| CAS: | 1947-58-6 |
| Bolling_Point: | 315.4±0.0 °C at 760 mmHg |
| Product_Name: | 2,3-Dibromo-1,4-butanediol |
| Melting_Point: | 88-90 °C(lit.) |
| Flash_Point: | 156.6±27.9 °C |
| MF: | C4H8Br2O2 |
| Density: | 2.1±0.1 g/cm3 |
|---|---|
| LogP: | 0.24 |
| Flash_Point: | 156.6±27.9 °C |
| Melting_Point: | 88-90 °C(lit.) |
| FW: | 247.913 |
| PSA: | 40.46000 |
| Exact_Mass: | 245.889084 |
| MF: | C4H8Br2O2 |
| Bolling_Point: | 315.4±0.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±1.5 mmHg at 25°C |
| Refractive_Index: | 1.584 |
| Hazard_Codes: | Xi: Irritant; |
|---|---|
| Symbol: | Warning |
| Warning_Statement: | P261-P305 + P351 + P338 |
| HS_Code: | 2905590090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | EK1575000 |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | S26-S36 |
| RIDADR: | NONH for all modes of transport |
| WGK_Germany: | 2 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)