3-Bromo-2-hydroxybenzaldehyde
Catalog No: FT-0600606
CAS No: 1829-34-1
- Chemical Name: 3-Bromo-2-hydroxybenzaldehyde
- Molecular Formula: C7H5BrO2
- Molecular Weight: 201.02
- InChI Key: STBGLXMINLWCNL-UHFFFAOYSA-N
- InChI: InChI=1S/C7H5BrO2/c8-6-3-1-2-5(4-9)7(6)10/h1-4,10H
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| FW: | 201.017 |
|---|---|
| CAS: | 1829-34-1 |
| Flash_Point: | 84.2±21.8 °C |
| MF: | C7H5BrO2 |
| Symbol: | Warning |
| Bolling_Point: | 215.6±20.0 °C at 760 mmHg |
| Melting_Point: | 53-57ºC |
| Product_Name: | 3-Bromo-2-hydroxybenzaldehyde |
| Density: | 1.7±0.1 g/cm3 |
| FW: | 201.017 |
|---|---|
| MF: | C7H5BrO2 |
| Exact_Mass: | 199.947281 |
| Flash_Point: | 84.2±21.8 °C |
| LogP: | 2.70 |
| PSA: | 37.30000 |
| Vapor_Pressure: | 0.1±0.4 mmHg at 25°C |
| Bolling_Point: | 215.6±20.0 °C at 760 mmHg |
| Melting_Point: | 53-57ºC |
| Density: | 1.7±0.1 g/cm3 |
| Refractive_Index: | 1.657 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H302-H315-H319-H335 |
| RIDADR: | NONH for all modes of transport |
| Risk_Statements(EU): | R22;R36/37/38 |
| Hazard_Codes: | Xn: Harmful; |
| HS_Code: | 2913000090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)