SB 204741
Catalog No: FT-0643481
CAS No: 152239-46-8
- Chemical Name: SB 204741
- Molecular Formula: C14H14N4OS
- Molecular Weight: 286.35
- InChI Key: USFUFHFQWXDVMH-UHFFFAOYSA-N
- InChI: InChI=1S/C14H14N4OS/c1-9-7-13(20-17-9)16-14(19)15-11-3-4-12-10(8-11)5-6-18(12)2/h3-8H,1-2H3,(H2,15,16,19)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 286.35200 |
| Density: | 1.38g/cm3 |
| CAS: | 152239-46-8 |
| Bolling_Point: | 335.9ºC at 760 mmHg |
| Product_Name: | 1-(1-methylindol-5-yl)-3-(3-methyl-1,2-thiazol-5-yl)urea |
| Melting_Point: | N/A |
| Flash_Point: | 157ºC |
| MF: | C14H14N4OS |
| Density: | 1.38g/cm3 |
|---|---|
| LogP: | 3.73320 |
| Flash_Point: | 157ºC |
| Refractive_Index: | 1.707 |
| FW: | 286.35200 |
| PSA: | 87.19000 |
| MF: | C14H14N4OS |
| Bolling_Point: | 335.9ºC at 760 mmHg |
| Vapor_Pressure: | 0.000116mmHg at 25°C |
| Exact_Mass: | 286.08900 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)