2-(Chloromethyl)benzoyl chloride
Catalog No: FT-0682401
CAS No: 42908-86-1
- Molecular Formula: 189.04
- Formula Weight: C8H6Cl2O
- Inchl Key: TXZFBHYDQGYOIT-UHFFFAOYSA-N
- Inchl: InChI=1S/C8H6Cl2O/c9-5-6-3-1-2-4-7(6)8(10)11/h1-4H,5H2
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 2-(Chloromethyl)benzoyl chloride |
|---|---|
| Bolling_Point: | 282.8±23.0 °C at 760 mmHg |
| MF: | C8H6Cl2O |
| Symbol: | GHS05, GHS06, GHS08 |
| Melting_Point: | N/A |
| CAS: | 42908-86-1 |
| Density: | 1.3±0.1 g/cm3 |
| FW: | 189.039 |
| Flash_Point: | 113.9±22.9 °C |
| Exact_Mass: | 187.979568 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| MF: | C8H6Cl2O |
| LogP: | 2.48 |
| Bolling_Point: | 282.8±23.0 °C at 760 mmHg |
| Density: | 1.3±0.1 g/cm3 |
| Computational_Chemistry: | ['1. XlogP :28 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :1 ', '4. Rotatable Bond Count :2 ', '5. Isotope Atom Count :N/A ', '6. TPSA 171 ', '7. Heavy Atom Count :11 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :147 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| PSA: | 17.07000 |
| FW: | 189.039 |
| Flash_Point: | 113.9±22.9 °C |
| Refractive_Index: | 1.558 |
| Risk_Statements(EU): | R11:Highly Flammable. R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Hazard_Codes: | F,Xi |
| HS_Code: | 2916399090 |
| Packing_Group: | II |
| WGK_Germany: | 3 |
| Warning_Statement: | P261-P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H302-H314-H331-H351 |
| Symbol: | GHS05, GHS06, GHS08 |
| RIDADR: | UN 3271 3/PG 2 |
| Hazard_Class: | 3.1 |
