DIPEPTIVEN
Catalog No: FT-0627662
CAS No: 39537-23-0
- Molecular Formula: 217.22
- Formula Weight: C8H15N3O4
- Inchl Key: HJCMDXDYPOUFDY-WHFBIAKZSA-N
- Inchl: InChI=1S/C8H15N3O4/c1-4(9)7(13)11-5(8(14)15)2-3-6(10)12/h4-5H,2-3,9H2,1H3,(H2,10,12)(H,11,13)(H,14,15)/t4-,5-/m0/s1
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 215 °C |
|---|---|
| CAS: | 39537-23-0 |
| MF: | C5H10N2O3 |
| Flash_Point: | 167.6±30.7 °C |
| Product_Name: | L-Alanyl-L-glutamine |
| Density: | 1.5±0.1 g/cm3 |
| FW: | 146.145 |
| Bolling_Point: | 353.5±52.0 °C at 760 mmHg |
| Refractive_Index: | 1.564 |
|---|---|
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| Flash_Point: | 167.6±30.7 °C |
| LogP: | -1.28 |
| Bolling_Point: | 353.5±52.0 °C at 760 mmHg |
| FW: | 146.145 |
| PSA: | 106.41000 |
| Computational_Chemistry: | ['1. XlogP :-44 ', '2. Hydrogen Bond Donor Count :4 ', '3. Hydrogen Bond Acceptor Count :5 ', '4. Rotatable Bond Count :6 ', '5. Isotope Atom Count :6 ', '6. TPSA 136 ', '7. Heavy Atom Count :15 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :267 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :2 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 215 °C |
| MF: | C5H10N2O3 |
| Exact_Mass: | 146.069138 |
| Density: | 1.5±0.1 g/cm3 |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| WGK_Germany: | 1 |
| Personal_Protective_Equipment: | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi |
| HS_Code: | 2924199090 |
| Safety_Statements: | S23-S24/25 |
