2-Ethylhexyl 4-dimethylaminobenzoate
Catalog No: FT-0616757
CAS No: 21245-02-3
- Molecular Formula: 277.4
- Formula Weight: C17H27NO2
- Inchl Key: WYWZRNAHINYAEF-UHFFFAOYSA-N
- Inchl: InChI=1S/C17H27NO2/c1-5-7-8-14(6-2)13-20-17(19)15-9-11-16(12-10-15)18(3)4/h9-12,14H,5-8,13H2,1-4H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 21245-02-3 |
| Flash_Point: | 121.7±14.0 °C |
| Product_Name: | 2-Ethylhexyl 4-dimethylaminobenzoate |
| Bolling_Point: | 382.9±25.0 °C at 760 mmHg |
| FW: | 277.402 |
| Melting_Point: | N/A |
| MF: | C17H27NO2 |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.514 |
|---|---|
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 121.7±14.0 °C |
| LogP: | 6.15 |
| Bolling_Point: | 382.9±25.0 °C at 760 mmHg |
| FW: | 277.402 |
| PSA: | 29.54000 |
| Computational_Chemistry: | ['1. XlogP :5 ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :3 ', '4. Rotatable Bond Count :9 ', '5. Isotope Atom Count :N/A ', '6. TPSA 295 ', '7. Heavy Atom Count :20 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :270 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :1 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C17H27NO2 |
| Exact_Mass: | 277.204193 |
| Molecular_Structure: | ['1 . Molar refractive index 8472 ', '2 . Molar volume (m3/mol)2812 ', '3 . Parachor (902K)6900 ', '4 表面张力(dyne/cm)362 ', '5 . Polarizability (10-24cm3)3358'] |
| Density: | 1.0±0.1 g/cm3 |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）0995 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）325 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index1542 ', '8. Flash point（ºC）>230 ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2922499990 |
| WGK_Germany: | 2 |
| Personal_Protective_Equipment: | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
