2-(2-Methoxyethoxy)acetic acid
Catalog No: FT-0614771
CAS No: 16024-56-9
- Molecular Formula: 134.13
- Formula Weight: C5H10O4
- Inchl Key: CLLLODNOQBVIMS-UHFFFAOYSA-N
- Inchl: InChI=1S/C5H10O4/c1-8-2-3-9-4-5(6)7/h2-4H2,1H3,(H,6,7)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS05 |
|---|---|
| CAS: | 16024-56-9 |
| Flash_Point: | >230 °F |
| Product_Name: | 2-(2-Methoxyethoxy)acetic acid |
| Bolling_Point: | 245-250 °C(lit.) |
| FW: | 134.13000 |
| Melting_Point: | N/A |
| MF: | C5H10O4 |
| Density: | 1.18 g/mL at 25 °C(lit.) |
| Refractive_Index: | n20/D 1.436(lit.) |
|---|---|
| Vapor_Pressure: | 0.00651mmHg at 25°C |
| Flash_Point: | >230 °F |
| Bolling_Point: | 245-250 °C(lit.) |
| FW: | 134.13000 |
| PSA: | 55.76000 |
| Computational_Chemistry: | ['1. XlogP :-05 ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :4 ', '4. Rotatable Bond Count :5 ', '5. Isotope Atom Count :N/A ', '6. TPSA 558 ', '7. Heavy Atom Count :9 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :81 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| MF: | C5H10O4 |
| Exact_Mass: | 134.05800 |
| Molecular_Structure: | ['分子性质数据 ', '1 . Molar refractive index 3026 ', '2 . Molar volume （m3/mol）1184 ', '3 . Parachor （902K）2922 ', '4 . Surface tension 370 ', '5 . Polarizability （10 -24cm 3）1199'] |
| Density: | 1.18 g/mL at 25 °C(lit.) |
| More_Info: | ['1. Appearance Unknow ', '2. Density（g/mL,25/4℃）118 ', '3. Relative vapor density（g/mL,Atmosphere =1）Unknow ', '4. Melting point（ºC）Unknow ', '5. Boiling point（ºC,Atmospheric pressure）245-250 ', '6. Boiling point（ºC,52kPa）Unknow ', '7. Refractive index1436 ', '8. Flash point（ºC）>230 ', '9. Specific rotation（º）Unknow ', '10. Spontaneous ignition point or ignition temperature（ºC）Unknow ', '11. Vapor pressure（kPa,25ºC）Unknow ', '12. Saturated vapor pressure（kPa,60ºC）Unknow ', '13. Combustion heat（KJ/mol）Unknow ', '14. Critical temperature（ºC）Unknow ', '15. Critical pressure（KPa）Unknow ', '16. Oil-water（Octanol /Water ）Logarithmic Value of Distribution Coefficient Unknow ', '17. Upper limit of explosion（%,V/V）Unknow ', '18. Lower limit of explosion（%,V/V）Unknow ', '19. Solubility Unknow'] |
| Symbol: | GHS05 |
|---|---|
| RIDADR: | UN 3265 8/PG 2 |
| HS_Code: | 2918990090 |
| Packing_Group: | II |
| Hazard_Class: | 8 |
| Risk_Statements(EU): | R34 |
| WGK_Germany: | 1 |
| Personal_Protective_Equipment: | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard_Codes: | C:Corrosive; |
| Warning_Statement: | P280-P305 + P351 + P338-P310 |
| Safety_Statements: | H314 |
