2,3-Dimethyl-5-ethylpyrazine
Catalog No: FT-0637263
CAS No: 15707-34-3
- Molecular Formula: 136.19
- Formula Weight: C8H12N2
- Inchl Key: CIBKSMZEVHTQLG-UHFFFAOYSA-N
- Inchl: InChI=1S/C8H12N2/c1-4-8-5-9-6(2)7(3)10-8/h5H,4H2,1-3H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 15707-34-3 |
| Flash_Point: | 70.8±17.6 °C |
| Product_Name: | 5-Ethyl-2,3-dimethylpyrazine |
| Bolling_Point: | 190.7±35.0 °C at 760 mmHg |
| FW: | 136.194 |
| Melting_Point: | 248-250 °C(lit.) |
| MF: | C8H12N2 |
| Density: | 1.0±0.1 g/cm3 |
| Refractive_Index: | 1.501 |
|---|---|
| Vapor_Pressure: | 0.7±0.4 mmHg at 25°C |
| Flash_Point: | 70.8±17.6 °C |
| LogP: | 1.63 |
| Bolling_Point: | 190.7±35.0 °C at 760 mmHg |
| FW: | 136.194 |
| PSA: | 25.78000 |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :0 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :1 ', '5. Isotope Atom Count :2 ', '6. TPSA 258 ', '7. Heavy Atom Count :10 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :103 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 248-250 °C(lit.) |
| MF: | C8H12N2 |
| Exact_Mass: | 136.100052 |
| Density: | 1.0±0.1 g/cm3 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R10:Flammable. R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R34:Causes burns. R36:Irritating to the eyes. |
| HS_Code: | 2933990090 |
| RIDADR: | 2924 |
| Safety_Statements: | H302 |
| Warning_Statement: | P301 + P312 + P330 |
