Hendecanoic acid
Catalog No: FT-0689759
CAS No: 112-37-8
- Molecular Formula: 186.29
- Formula Weight: C11H22O2
- Inchl Key: ZDPHROOEEOARMN-UHFFFAOYSA-N
- Inchl: InChI=1S/C11H22O2/c1-2-3-4-5-6-7-8-9-10-11(12)13/h2-10H2,1H3,(H,12,13)
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 28-31 °C(lit.) |
|---|---|
| CAS: | 112-37-8 |
| MF: | C11H22O2 |
| Flash_Point: | 128.2±11.9 °C |
| Product_Name: | Undecanoic acid |
| Density: | 0.9±0.1 g/cm3 |
| FW: | 186.291 |
| Bolling_Point: | 283.3±3.0 °C at 760 mmHg |
| Refractive_Index: | 1.446 |
|---|---|
| Vapor_Pressure: | 0.0±0.6 mmHg at 25°C |
| Flash_Point: | 128.2±11.9 °C |
| LogP: | 4.50 |
| Bolling_Point: | 283.3±3.0 °C at 760 mmHg |
| Water_Solubility: | insoluble |
| PSA: | 37.30000 |
| Molecular_Structure: | ['1 . Molar refractive index 5457 ', '2 . Molar volume 2047 ', '3 . Parachor （902K）4915 ', '4 . Surface tension 332 ', '5 . Polarizability 2163'] |
| Computational_Chemistry: | ['1. XlogP :N/A ', '2. Hydrogen Bond Donor Count :1 ', '3. Hydrogen Bond Acceptor Count :2 ', '4. Rotatable Bond Count :9 ', '5. Isotope Atom Count :N/A ', '6. TPSA 373 ', '7. Heavy Atom Count :13 ', '8. Topological Polar Surface Area :0 ', '9. Complexity :121 ', '10. Isotope Atom Count :0 ', '11. Defined Atom Stereocenter Count :0 ', '12. Undefined Atom Stereocenter Count :0 ', '13. Defined Bond Stereocenter Count :0 ', '14. Undefined Bond Stereocenter Count :0 ', '15. Covalently-Bonded Unit Count :1'] |
| Melting_Point: | 28-31 °C(lit.) |
| MF: | C11H22O2 |
| Exact_Mass: | 186.161987 |
| FW: | 186.291 |
| Density: | 0.9±0.1 g/cm3 |
| More_Info: | ['1. Appearance Colourless 结晶 ', '2相对. Density08907 ', '3. Melting point（℃）286 ', '4. Boiling point（℃）280 ', '5折光率14294 ', '6. Flash point（℃）＞110 ', '7. Solubility Soluble in Ethanol and Ethyl ether ，Insoluble in Water 。'] |
| Risk_Statements(EU): | R36/37/38 |
|---|---|
| WGK_Germany: | 1 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RTECS: | YQ2275000 |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi:Irritant; |
| HS_Code: | 29159080 |
| Safety_Statements: | S26-S36 |
