ETHYL 8-CHLORO-6-HYDROXYOCTANATE
Catalog No: FT-0633280
CAS No: 1070-65-1
- Molecular Formula: 222.71
- Formula Weight: C10H19ClO3
- Inchl Key: YSFJHUHDLIFMPB-UHFFFAOYSA-N
- Inchl: InChI=1S/C10H19ClO3/c1-2-14-10(13)6-4-3-5-9(12)7-8-11/h9,12H,2-8H2,1H3
| Assay | Pack | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Melting_Point: | 136 °C |
|---|---|
| CAS: | 1070-65-1 |
| MF: | C10H19ClO3 |
| Flash_Point: | 142ºC |
| Product_Name: | ethyl 8-chloro-6-hydroxyoctanoate |
| Density: | 1.079g/cm3 |
| FW: | 222.70900 |
| Bolling_Point: | 311.2ºC at 760 mmHg |
| Refractive_Index: | 1.459 |
|---|---|
| Vapor_Pressure: | 5.08E-05mmHg at 25°C |
| Flash_Point: | 142ºC |
| LogP: | 2.09970 |
| Bolling_Point: | 311.2ºC at 760 mmHg |
| FW: | 222.70900 |
| PSA: | 46.53000 |
| Melting_Point: | 136 °C |
| MF: | C10H19ClO3 |
| Exact_Mass: | 222.10200 |
| Molecular_Structure: | ['1 . Molar refractive index 5649 ', '2 . Molar volume 2063 ', '3 . Parachor （902K）5072 ', '4 . Surface tension 365 ', '5 . Polarizability 2239'] |
| Density: | 1.079g/cm3 |
| Safety_Statements: | S26-S36/37/39 |
|---|---|
| Hazard_Codes: | Xi |
| HS_Code: | 2918199090 |
| Risk_Statements(EU): | R36/37/38:Irritating to eyes, respiratory system and skin . |
