![[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol (CAS: 173143-73-2) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0774175.webp "[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol chemical structure")
[(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol
Catalog No: FT-0774175
CAS No: 173143-73-2
- Chemical Name: [(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol
- Molecular Formula: C11H15NO
- Molecular Weight: 177.24 g/mol
- InChI Key: BMEHDCBKAUDFBH-BVAQLPTGSA-N
- InChI: InChI=1S/C11H15NO/c1-9(12-7-11(12)8-13)10-5-3-2-4-6-10/h2-6,9,11,13H,7-8H2,1H3/t9-,11+,12?/m1/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 173143-73-2 |
|---|---|
| MF: | C11H15NO |
| Density: | 1.118g/cm3 |
| Flash_Point: | >230 °F |
| Melting_Point: | 30-35ºC(lit.) |
| Product_Name: | [(2S)-1-[(1R)-1-phenylethyl]aziridin-2-yl]methanol |
| Symbol: | GHS07 |
| Bolling_Point: | 240.6ºC at 760 mmHg |
| FW: | 177.24300 |
| Bolling_Point: | 240.6ºC at 760 mmHg |
|---|---|
| Density: | 1.118g/cm3 |
| MF: | C11H15NO |
| LogP: | 1.36200 |
| Melting_Point: | 30-35ºC(lit.) |
| Exact_Mass: | 177.11500 |
| Vapor_Pressure: | 0.0203mmHg at 25°C |
| Flash_Point: | >230 °F |
| FW: | 177.24300 |
| Refractive_Index: | 1.581 |
| PSA: | 23.24000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | S26 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.webp "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.webp "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
