![2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetic acid (CAS: 123000-45-3) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0773039.png "2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetic acid chemical structure")
2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetic acid
Catalog No: FT-0773039
CAS No: 123000-45-3
- Chemical Name: 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetic acid
- Molecular Formula: C9H13NO5
- Molecular Weight: 215.20 g/mol
- InChI Key: YPCIKCQPODDZAT-LYFYHCNISA-N
- InChI: InChI=1S/C9H13NO5/c1-5-2-8(11)6(3-9(12)13)7(5)4-10(14)15/h5-7H,2-4H2,1H3,(H,12,13)/t5-,6-,7+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 123000-45-3 |
|---|---|
| MF: | C9H13NO5 |
| Density: | 1.256g/cm3 |
| Flash_Point: | 190.6ºC |
| Melting_Point: | 58-62ºC(lit.) |
| Product_Name: | 2-[(1S,2R,3S)-3-methyl-2-(nitromethyl)-5-oxocyclopentyl]acetic acid |
| Symbol: | GHS07 |
| Bolling_Point: | 433.1ºC at 760 mmHg |
| FW: | 215.20300 |
| Bolling_Point: | 433.1ºC at 760 mmHg |
|---|---|
| Density: | 1.256g/cm3 |
| MF: | C9H13NO5 |
| LogP: | 1.10230 |
| Melting_Point: | 58-62ºC(lit.) |
| Exact_Mass: | 215.07900 |
| Vapor_Pressure: | 1.03E-08mmHg at 25°C |
| Flash_Point: | 190.6ºC |
| FW: | 215.20300 |
| Refractive_Index: | 1.489 |
| PSA: | 100.19000 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Symbol: | GHS07 |
| Safety_Statements: | S26 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Hazard_Codes: | Xi |
| Risk_Statements(EU): | R36/37/38 |
| RIDADR: | NONH for all modes of transport |
