![(1S,4S)-bicyclo[2.2.2]octane-2,5-dione (CAS: 177931-43-0) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0770867.png "(1S,4S)-bicyclo[2.2.2]octane-2,5-dione chemical structure")
(1S,4S)-bicyclo[2.2.2]octane-2,5-dione
Catalog No: FT-0770867
CAS No: 177931-43-0
- Chemical Name: (1S,4S)-bicyclo[2.2.2]octane-2,5-dione
- Molecular Formula: C8H10O2
- Molecular Weight: 138.16
- InChI Key: WMJKUNDVKHUCMV-WDSKDSINSA-N
- InChI: InChI=1S/C8H10O2/c9-7-4-6-2-1-5(7)3-8(6)10/h5-6H,1-4H2/t5-,6-/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 177931-43-0 |
|---|---|
| MF: | C8H10O2 |
| Density: | N/A |
| Flash_Point: | N/A |
| Melting_Point: | N/A |
| Product_Name: | (1S,4S)-bicyclo[2.2.2]octane-2,5-dione |
| Symbol: | GHS05, GHS07 |
| Bolling_Point: | N/A |
| FW: | 138.16400 |
| Exact_Mass: | 138.06800 |
|---|---|
| MF: | C8H10O2 |
| LogP: | 0.94460 |
| PSA: | 34.14000 |
| FW: | 138.16400 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Safety_Statements: | H302-H315-H318-H335 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| Symbol: | GHS05, GHS07 |
| RIDADR: | NONH for all modes of transport |
