2-ethylhexyl 4-aminobenzoate
Catalog No: FT-0761109
CAS No: 26218-04-2
- Chemical Name: 2-ethylhexyl 4-aminobenzoate
- Molecular Formula: C15H23NO2
- Molecular Weight: 249.35
- InChI Key: ZJQXUTDROPGVLH-UHFFFAOYSA-N
- InChI: InChI=1S/C15H23NO2/c1-3-5-6-12(4-2)11-18-15(17)13-7-9-14(16)10-8-13/h7-10,12H,3-6,11,16H2,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Bolling_Point: | 384.962ºC at 760 mmHg |
|---|---|
| CAS: | 26218-04-2 |
| MF: | C15H23NO2 |
| Density: | 1.016g/cm3 |
| Melting_Point: | N/A |
| Product_Name: | 2-Ethylhexyl 4-aminobenzoate |
| Flash_Point: | 222.018ºC |
| FW: | 249.34900 |
| Bolling_Point: | 384.962ºC at 760 mmHg |
|---|---|
| Density: | 1.016g/cm3 |
| MF: | C15H23NO2 |
| LogP: | 4.22320 |
| Exact_Mass: | 249.17300 |
| Vapor_Pressure: | 0mmHg at 25°C |
| Flash_Point: | 222.018ºC |
| FW: | 249.34900 |
| Refractive_Index: | 1.52 |
| PSA: | 52.32000 |
| Hazard_Codes: | N: Dangerous for the environment; |
|---|---|
| HS_Code: | 2922499990 |
| Risk_Statements(EU): | 50/53 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | 60-61 |
Related Products
4-methyl-N-(4-methylpyridin-2-yl)benzenesulfonamide;hydrochloride
2-(5-acetyloxy-4,6,7-trimethyl-2,3-dihydro-1-benzofuran-2-yl)acetic acid