bis(2-methylphenyl)phosphane
Catalog No: FT-0758554
CAS No: 29949-64-2
- Chemical Name: bis(2-methylphenyl)phosphane
- Molecular Formula: C14H15P
- Molecular Weight: 214.24 g/mol
- InChI Key: QHRVFPPZMPHYHA-UHFFFAOYSA-N
- InChI: InChI=1S/C14H15P/c1-11-7-3-5-9-13(11)15-14-10-6-4-8-12(14)2/h3-10,15H,1-2H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 29949-64-2 |
|---|---|
| MF: | C14H15P |
| Density: | N/A |
| Flash_Point: | >110 °C |
| Melting_Point: | N/A |
| Product_Name: | bis(2-methylphenyl)phosphane |
| Symbol: | GHS07 |
| Bolling_Point: | N/A |
| FW: | 214.24300 |
| Exact_Mass: | 214.09100 |
|---|---|
| MF: | C14H15P |
| LogP: | 2.93270 |
| PSA: | 13.59000 |
| FW: | 214.24300 |
| Flash_Point_(F): | >230 °F |
|---|---|
| Flash_Point_(C): | >110 °C |
| Safety_Statements: | H302-H315-H319-H335 |
| Symbol: | GHS07 |
| Warning_Statement: | P261-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
Related Products
4-Methyl-3-cyclohexen-1-one (contain up to 10% 4-methyl cyclohexanone)
ethyl 2,7-dioxo-2,7-dihydro-3H-naphtho[1,2,3-de]quinoline-1-carboxylate